Framework Type DFO
| Material Name: | DAF-1 | ||||
Chemical Formula: |
|(DecM+2)7 (H2O)40 | [Mg14Al52P66O264]-DFO DecM+2 = C16H38N2+2 = decamethonium ion = trimethyl-[10-(trimethylazaniumyl)decyl]azanium SMILES: C[N+](C)(C)CCCCCCCCCC[N+](C)(C)C Images: stick  or 3D |
||||
| Unit Cell: |
hexagonal |
P 6/m m m (# 191) |
|||
| a' = 22.3510 Å | b' = 22.3510 Å | c' = 21.6930 Å | |||
| α' = 90.000° | β' = 90.000° | γ' = 120.000° | |||
| Framework Density: |
14.1 T/1000 Å3 |
||||
[001] 8 3.4 x 5.6}*** <-> {[001] 12 6.2 x 6.2 <-> | References: |
||||
| Wright, P.A., Jones, R.H., Natarajan, S., Bell, R.G., Chen, J.S., Hursthouse, M.B. and Thomas, J.M. | ||||
| "Synthesis and Structure of a Novel Large-Pore Microporous Magnesium-Containing Aluminophosphate (DAF-1)" | ||||
| Chem. Commun., , 633-635 (1993) | ||||
| Muncaster, G., Sankar, G., Catlow, C.R.A., Thomas, J.M., Bell, R.G., Wright, P.A., Coles, S., Teat, S.J., Clegg, W. and Reeve, W. | ||||
| "An in situ microcrystal X-ray diffraction study of the synthetic aluminophosphate zeotypes DAF-1 and CoAPSO-44" | ||||
| Chem. Mater., 11, 158-163 (1999) | ||||
| Material name: DAF-1 | ||||
| Chemical formula: [Mg14Al52P66O264]-DFO | ||||
| |
Name and Code derivation: |
|
|
Davy Faraday Research Laboratory - one DAF-1 (one) DFO | ||
| Limiting Rings |
|
 |
 |
12-ring viewed along [001] | 8-ring viewed normal to [001] |
 |
 |
2nd 12-ring viewed along [001] | 10-ring viewed normal to [001] |