Material Name: | STA-1 | ||||
Chemical Formula: |
|(DQH+2)2.6 (H2O)6 | [Mg5Al23P28O112]-SAO DQH+2 = C21H40N2+2 = 1,7-diquinuclidiniumheptane = 1-[7-(1-azoniabicyclo[2.2.2]octan-1-yl)heptyl]-1-azoniabicyclo[2.2.2]octane SMILES: C1C[N+]2(CCC1CC2)CCCCCCC[N+]34CCC(CC3)CC4 Images: stick ![]() |
||||
Unit Cell: |
tetragonal |
P -4 n 2 (# 118) |
|||
a' = 13.8100 Å | b' = 13.8100 Å | c' = 21.9690 Å | |||
α' = 90.000° | β' = 90.000° | γ' = 90.000° | |||
Framework Density: |
13.4 T/1000 Å3 |
|
Channels: |
<100>12 6.5 x 7.2** <-> [001] 12 7.0 x 7.0*
|
|
Name and Code derivation: |
|
University of Saint Andrews - one STA-1 (one) SAO |