Material Name: | SSZ-23 | ||||
Chemical Formula: |
|(TMAda+)4.1 F3.3(OH)0.8| [Si64O128]-STT TMAda+ = C13H24N+ = trimethylaminoadamantane ion = 1-adamantyl(trimethyl)azanium SMILES: C[N+](C)(C)C12CC3CC(C1)CC(C3)C2 Images: stick ![]() |
||||
Unit Cell: |
monoclinic |
P 1 21/n 1 (# 14) |
|||
a' = 12.9590 Å | b' = 21.7920 Å | c' = 13.5980 Å | |||
α' = 90.000° | β' = 101.850° | γ' = 90.000° | |||
Framework Density: |
17.0 T/1000 Å3 |
|
Channels: |
[101] 9 3.7 x 5.3* <-> [001] 7 2.4 x 3.5*
|
References: |
|||
Camblor, M.A., Díaz-Cabañas, M.-J., Perez-Pariente, J., Teat, S.J., Clegg, W., Shannon, I.J., Lightfoot, P., Wright, P.A. and Morris, R.E. | |||
"SSZ-23: An odd zeolite with pore openings of seven and nine tetrahedral atoms" | |||
Angew. Chem. Int. Ed., 37, 2122-2126 (1998) 3.0.co;2-6> |
|
Name and Code derivation: |
|
Standard Oil Synthetic Zeolite - twenty-three SSZ-23 (twenty-three) STT |