Material Name: | IM-10 | ||||
Chemical Formula: |
|(HM+2)2 F4 | [Ge40O80]-UOZ HM+2 = C12H30N2+2 = hexamethonium ion = trimethyl-[6-(trimethylazaniumyl)hexyl]azanium SMILES: C[N+](C)(C)CCCCCC[N+](C)(C)C Images: stick ![]() |
||||
Unit Cell: |
tetragonal |
P -4 n 2 (# 118) |
|||
a' = 9.1596 Å | b' = 9.1596 Å | c' = 28.5614 Å | |||
α' = 90.000° | β' = 90.000° | γ' = 90.000° | |||
Framework Density: |
16.7 T/1000 Å3 |
|
Channels: |
apertures formed by 6-rings only
|
|
Name and Code derivation: |
|
Institut Français du Pétrole and University of Mulhouse - ten IM-10, Mulhouse (one-zero) UOZ |